MondayMondayJanuary 11, 2010January 11, 2010

(Review for Semester (Review for Semester Final Exam)Final Exam)

Day 2Day 2

No Bell Ringers this week

Bell Ringer 1-11-10

Please pick up your Test and Scantron

from Table I

AnnouncementsAnnouncements Remediation for Test 6

begins today and ends this Friday.

The notes for our semester exam review are on my teacher website. Download them to study.

Assignments Currently OpenAssignments Currently Open

AssignmentAssignment PagePage Date Date IssuedIssued

Date Into Date Into GradeSpeedGradeSpeed

Last Day Last Day to Turn Into Turn In

WS: Predicting Products of Chemical Reactions

215 12/15 1/5 1/12

WS: Calculating Quantities in Chemical Reactions

217 12/16 1/6 1/13

WS: Limiting Reactants 225 1/4 1/11 1/15WS: More Practice with Equations

227 1/5 1/12 1/15

Day 2Day 2

Review for Review for Semester Final Semester Final

ExamExam

Determine the name of the Determine the name of the following compound:following compound:

KBrKBr

Item 1Item 1

Potassium bromidePotassium bromide

Determine the name of Determine the name of the following compound: the following compound:

ZnOZnO

Item 2Item 2

zinc (II) oxidezinc (II) oxide

Determine the name of the Determine the name of the following compound:following compound:

CaCa33(PO(PO44))22

Item 3Item 3

calcium phosphatecalcium phosphate

Determine the name of the Determine the name of the following compound:following compound:

CClCCl44

Item 4Item 4

carbon tetrachloridecarbon tetrachloride

In the picture, In the picture, identify the identify the

three common three common phases of phases of

matter and matter and explain how explain how they differ at they differ at the particle the particle

level.level.

Item 5Item 5

Describe Rutherford’s gold foil Describe Rutherford’s gold foil experiment (illustrated below) that experiment (illustrated below) that lead to the discovery of the atomic lead to the discovery of the atomic

nucleus.nucleus.

Item 6Item 6

A ______________ property is a A ______________ property is a characteristic that can be characteristic that can be

observed or measured without observed or measured without changing the identity of the changing the identity of the

substance. Give five examples substance. Give five examples of this type of property.of this type of property.

Item 7Item 7

physicalphysical

In the following reaction, how many In the following reaction, how many moles of magnesium would be moles of magnesium would be

required to react with 5.0 moles of required to react with 5.0 moles of oxygen gas? Be sure to balance the oxygen gas? Be sure to balance the

equation first!equation first!

Mg + OMg + O22 ææ MgO MgO

Item 8Item 8

2:1:22:1:210 mol Mg10 mol Mg

In the following reaction, 12.0 moles of In the following reaction, 12.0 moles of chlorine gas would produce how many chlorine gas would produce how many moles of hydrochloric acid? Be sure to moles of hydrochloric acid? Be sure to

balance the equation first!balance the equation first!

HH22 + Cl + Cl22 ææ HCl HCl

Item 9Item 9

1:1:21:1:224 mol HCl24 mol HCl

In the following reaction, how many In the following reaction, how many grams of water would be required to grams of water would be required to

produce 20.0 moles of hydrogen gas? Be produce 20.0 moles of hydrogen gas? Be sure to balance the equation first!sure to balance the equation first!

Ca + HCa + H22O O ææ Ca(OH) Ca(OH)22 + H + H22

Item 10Item 10

1:2:1:11:2:1:1720 g H720 g H22OO

In the following reaction, how many In the following reaction, how many moles of oxygen gas would be moles of oxygen gas would be

produced if 10.0 moles of KClOproduced if 10.0 moles of KClO3 3 decompose? Be sure to balance the decompose? Be sure to balance the

equation first!equation first!

KClOKClO33 ææ KCl + O KCl + O22

Item 11Item 11

2:2:32:2:315 mol O15 mol O22

Determine the type of reaction, Determine the type of reaction, predict the product(s), and predict the product(s), and then balance the equation.then balance the equation.

FeS + HClFeS + HCl ææ

Item 12Item 12

Double ReplacementDouble ReplacementFeClFeCl22 + H + H22SS

1:2:1:11:2:1:1

Which of the following was probably the Which of the following was probably the hypothesis for the experiment below?hypothesis for the experiment below?A. If temperature increases, then the A. If temperature increases, then the growth of bread mold increases.growth of bread mold increases.B. If the type of nutrient changes, then this B. If the type of nutrient changes, then this will cause bread mold to grow faster at will cause bread mold to grow faster at higher temperatures.higher temperatures.C. If the size of the plate changes, then C. If the size of the plate changes, then this determines the temperature of the this determines the temperature of the bread mold.bread mold.D. If the mold’s growth changes, then this D. If the mold’s growth changes, then this determines the temperature of the bread determines the temperature of the bread mold.mold.

Item 13Item 13

In the picture below, which is the In the picture below, which is the most precise answer you can give most precise answer you can give for the length of the nail?for the length of the nail?– 6 inches6 inches– 6 cm6 cm– 6.3 cm6.3 cm– 6.35 cm6.35 cm– 6.358 cm6.358 cm

Item 14Item 14

Which piece Which piece of equipment of equipment should be should be used to used to precisely precisely measure 40.0 measure 40.0 mL of a dilute mL of a dilute sodium sodium hydroxide hydroxide solution?solution?

Item 15Item 15

What is true concerning What is true concerning the picture below?the picture below?

Item 16Item 16

All are the same element All are the same element (H)(H)

Determine all of the Determine all of the information that you can from information that you can from the isotopic notation below.the isotopic notation below.

Item 17Item 17

carbon

6 protons

total protons + neutrons

Using the chart, contrast Using the chart, contrast mixtures with pure substances.mixtures with pure substances.

Item 18Item 18

Physical

separation

Express a mass of 5.712 Express a mass of 5.712 grams in milligrams and grams in milligrams and

in kilograms.in kilograms.

Item 19Item 19

5712. milligrams5712. milligrams

0.005712 kilograms0.005712 kilograms

Complete the following conversions:Complete the following conversions:

10.5 g = 10.5 g = kg kg1.57 km = 1.57 km = m m3.54 mg = g3.54 mg = g3.5 mL = L3.5 mL = L

Item 20Item 20

0.0105

1570.

0.0035

0.0035

Draw the orbital notation for Draw the orbital notation for the element oxygen.the element oxygen.

Item 21Item 21

Identify the elements having the Identify the elements having the following electron configurations:following electron configurations:

Item 22Item 22

1s1s22,2s,2s22,2p,2p22 carboncarbon

1s1s22,2s,2s22,2p,2p66,3s,3s11 sodiumsodium

1s1s22,2s,2s22,2p,2p66,3s,3s22,3p,3p44 sulfursulfur

[Ar],4s[Ar],4s11 potassiumpotassium

Write the balanced formula equation Write the balanced formula equation for the following word equation:for the following word equation:

potassium + water potassium + water ææpotassium hydroxide + hydrogen gaspotassium hydroxide + hydrogen gas

Item 23Item 23

KK + HOH + HOH ææ KOHKOH + + HH22

2 22

Translate the following sentence into a Translate the following sentence into a balanced formula equation:balanced formula equation:

Iron (III) metal reacts with chlorine gas Iron (III) metal reacts with chlorine gas to produce iron (III) chloride.to produce iron (III) chloride.

Item 24Item 24

+ Cl+ Cl22 ææ FeClFeCl332 23FeFe

Write the electron configuration Write the electron configuration notation for the element notation for the element

chlorine and then circle the chlorine and then circle the valence electrons.valence electrons.

Item 25Item 25

1s2 2s2 2p6 3s2 3p5

How many valence How many valence electrons does an electrons does an aluminum atom aluminum atom

have?have?

Item 26Item 26

33

List four important properties List four important properties of metals.of metals.

Item 27Item 27

Good conductors of heat and Good conductors of heat and electricityelectricity

Some degree of shiny (luster)Some degree of shiny (luster)

MalleableMalleable

DuctileDuctile

An object has a mass of 50.5 grams An object has a mass of 50.5 grams and a volume of 61.2 cmand a volume of 61.2 cm33. Calculate . Calculate the density of this object, and then the density of this object, and then

determine if the object would sink or determine if the object would sink or float in water.float in water.

Item 28Item 28

Density = mass / volumeDensity = mass / volume Density = 50.5 g / 61.2 cmDensity = 50.5 g / 61.2 cm33

Density = 0.825 g/cmDensity = 0.825 g/cm33

floatfloat

The label shown contains information about The label shown contains information about some harmful effects of acetone. A group of some harmful effects of acetone. A group of

students plans to use acetone to rinse out a glass students plans to use acetone to rinse out a glass container. A second group of students is working container. A second group of students is working at the same lab table. Which of the following lab at the same lab table. Which of the following lab procedures should the second group of students procedures should the second group of students

avoid?avoid?heating water with an open flameheating water with an open flame

pouring hydrochloric acid into a beakerpouring hydrochloric acid into a beakerfiltering precipitates from a liquid solutionfiltering precipitates from a liquid solution

collecting oxygen from plants in a test tubecollecting oxygen from plants in a test tube

Item 29Item 29

This picture indicates that the This picture indicates that the chemical represented ischemical represented isa.a. pressurizedpressurizedb.b. corrosivecorrosivec.c. flammableflammabled.d. toxictoxic

Item 30Item 30

Atoms are normally electrically Atoms are normally electrically neutral. Which of the following neutral. Which of the following statements explains why this is statements explains why this is

true?true?a.a. In a neutral atom, the number of In a neutral atom, the number of

neutrons always equals the number of neutrons always equals the number of protons.protons.

b.b. In a neutral atom, the number of protons In a neutral atom, the number of protons equals the number of electronsequals the number of electrons

c.c. In a neutral atom, no charged particles In a neutral atom, no charged particles are found anywhere in the atomare found anywhere in the atom

d.d. In a neutral atom, gravity is the most In a neutral atom, gravity is the most powerful force acting on its particles.powerful force acting on its particles.

Item 31Item 31

Which of the following is true about Which of the following is true about the three main sub-atomic particles: the three main sub-atomic particles:

protons, neutrons, and electrons?protons, neutrons, and electrons?a.a. Protons provide mass and charge to Protons provide mass and charge to

an atom.an atom.b.b.Neutrons are the particles that Neutrons are the particles that

determine the identity of an atom.determine the identity of an atom.c.c. Electrons provide as much charge Electrons provide as much charge

as neutrons in an atom.as neutrons in an atom.d.d. Protons go back and forth between Protons go back and forth between

the nucleus and the electron cloud.the nucleus and the electron cloud.

Item 32Item 32

Which of the following do all Which of the following do all carbon atoms have in common?carbon atoms have in common?

– All carbon atoms have the All carbon atoms have the same number of neutrons.same number of neutrons.

– All carbon atoms have the All carbon atoms have the same number of protons. same number of protons.

– All carbon atoms are All carbon atoms are radioactive. radioactive.

– All carbon atoms have 8 All carbon atoms have 8 electrons.electrons.

Item 33Item 33

Which of the following is Which of the following is correct about the number of correct about the number of particles a lithium atom has?particles a lithium atom has?

a.a. 3 protons, 3 neutrons, 4 electrons3 protons, 3 neutrons, 4 electronsb.b. 7 protons, 3 neutrons, 7 electrons7 protons, 3 neutrons, 7 electronsc.c. 3 protons, 3 neutrons, 3 electrons3 protons, 3 neutrons, 3 electronsd.d. 3 protons, 4 neutrons, 3 electrons3 protons, 4 neutrons, 3 electrons

Item 34Item 34

The Law of Conservation of Mass states that mass The Law of Conservation of Mass states that mass is neither destroyed nor created during is neither destroyed nor created during ordinary chemical reactions or physical ordinary chemical reactions or physical

changes. Which one of the following is the changes. Which one of the following is the best example of this Law?best example of this Law?

a.a. The number of protons must equal the number The number of protons must equal the number of electrons in a neutral atom.of electrons in a neutral atom.

b.b. Sodium chloride (NaCl) always consists of Sodium chloride (NaCl) always consists of 39.34% by mass of the element sodium (Na) 39.34% by mass of the element sodium (Na) and 60.66% by mass of the element and 60.66% by mass of the element chlorine(Cl.)chlorine(Cl.)

c.c. All matter is composed of extremely small All matter is composed of extremely small particles called atoms.particles called atoms.

d.d. Chemical equations must be balanced to Chemical equations must be balanced to accurately represent the changes occurring accurately represent the changes occurring during a chemical reaction.during a chemical reaction.

Item 35Item 35

Balance the following Balance the following chemical equation.chemical equation.Fe + OFe + O22 ææ Fe Fe22OO33

Item 36Item 36

4 23

Balance the following Balance the following chemical equation.chemical equation.

Fe + HFe + H22O O ææ Fe Fe33OO44 + H + H22

Item 37Item 37

3 4 41

Balance the following Balance the following chemical equation.chemical equation.

FeS + HCl FeS + HCl ææ H H22S + FeClS + FeCl22

Item 38Item 38

2

Name an element that has a Name an element that has a 33++ oxidation state. oxidation state.

What does this mean?What does this mean?

Item 39Item 39

Al, Ga, In, FeAl, Ga, In, FeThis means that they lose 3 This means that they lose 3 electrons in the process of electrons in the process of

ionization.ionization.

Determine the compound that Determine the compound that is formed when the iron (II) ion is formed when the iron (II) ion

bonds with the PObonds with the PO443-3- ion. ion.

Item 40Item 40

FeFe2+2+ POPO443-3-

FeFe33(PO(PO44))22

What is the main distinction What is the main distinction between ionic and covalent between ionic and covalent

bonding?bonding?

Item 41Item 41

Ionic bonding involves a Ionic bonding involves a transfer of electrons (metals transfer of electrons (metals lose and non-metals gain.)lose and non-metals gain.)

Covalent bonding involves a Covalent bonding involves a sharing of pairs of electrons sharing of pairs of electrons

between non-metals.between non-metals.

What type of bonding What type of bonding would be expected would be expected

between the following between the following atoms?atoms?H and FH and F

Cu and SCu and SI and BrI and Br

Item 42Item 42

covalentcovalent

ionicionic

covalentcovalent

Distinguish between ionic and Distinguish between ionic and molecular compounds in terms of molecular compounds in terms of

the basic units that each is the basic units that each is composed of.composed of.

Item 43Item 43

Ionic compounds are composed of Ionic compounds are composed of a matrix of particles held together a matrix of particles held together

by their opposite charges.by their opposite charges.Covalent compounds are Covalent compounds are

composed of individual particles composed of individual particles called molecules.called molecules.

Compound B has lower melting and Compound B has lower melting and boiling points than compound A. At boiling points than compound A. At the same temperature, compound B the same temperature, compound B

vaporizes faster and to a greater vaporizes faster and to a greater extent than compound A. If one of extent than compound A. If one of these compounds is ionic and the these compounds is ionic and the

other is molecular, which would you other is molecular, which would you expect to be molecular? Ionic?expect to be molecular? Ionic?

Item 44Item 44

Compound B is molecular.Compound B is molecular.

Compound A is ionic.Compound A is ionic.

Which of the following lists of Which of the following lists of elements should have similar elements should have similar

chemical properties?chemical properties?

a.a. Li, B, N, FLi, B, N, Fb.b. Li, Na, K, RbLi, Na, K, Rbc.c. H, Mg, As, NeH, Mg, As, Ned.d. K, Ca, Ga, SeK, Ca, Ga, Se

Item 45Item 45

Which of the following would not be Which of the following would not be considered to be periodic?considered to be periodic?

a.a. Elements in the same group have Elements in the same group have similar chemical properties.similar chemical properties.

b.b. Certain properties have similar-looking Certain properties have similar-looking graphs in the seven periods.graphs in the seven periods.

c.c. Hydrogen has properties unlike any Hydrogen has properties unlike any other element on the Periodic Table.other element on the Periodic Table.

d.d. If you know the value of a property for If you know the value of a property for some elements in a group you should some elements in a group you should be able to predict that value for other be able to predict that value for other

elements in that group. elements in that group.

Item 46Item 46

Of the elements potassium, Of the elements potassium, gallium, germanium, and gallium, germanium, and

bromine, which has the largest bromine, which has the largest atomic radius?atomic radius?

Item 47Item 47

Atomic radius decreases Atomic radius decreases across a period, therefore across a period, therefore potassium has the largest potassium has the largest

atomic radius.atomic radius.

Of the elements rubidium, Of the elements rubidium, strontium, indium, and strontium, indium, and

iodine, which has the highest iodine, which has the highest ionization energy?ionization energy?

Item 48Item 48

Ionization energy increases Ionization energy increases across a period, therefore across a period, therefore

iodine has the highest iodine has the highest ionization energy.ionization energy.

Of the elements lithium, Of the elements lithium, sodium, potassium, and sodium, potassium, and cesium, which has the cesium, which has the

highest electronegativity?highest electronegativity?

Item 49Item 49

Electronegativity decreases Electronegativity decreases down a group, therefore down a group, therefore lithium has the highest lithium has the highest

electronegativity.electronegativity.

Which of the following deals Which of the following deals with a physical change in with a physical change in

matter?matter?

The shovel has rusted.The shovel has rusted.The water has frozen.The water has frozen.

The pizza has been digested.The pizza has been digested.The wood has been burned.The wood has been burned.

Item 50Item 50

An ice cube melts to liquid water, and An ice cube melts to liquid water, and then evaporates into water vapor. then evaporates into water vapor.

Which of the following statements is Which of the following statements is true?true?

a.a. A chemical decomposition has A chemical decomposition has taken place.taken place.

b.b. The water in the ice is not matter The water in the ice is not matter anymore when it turns into a gas.anymore when it turns into a gas.

c.c. A physical change has occurred.A physical change has occurred.d.d. No change has taken place at all.No change has taken place at all.

Item 51Item 51

What is the main difference between What is the main difference between physical and chemical changes? physical and chemical changes?

Give an example of each.Give an example of each.

Item 52Item 52

Physical changes do not change the Physical changes do not change the chemical composition of the involved chemical composition of the involved materials. For example, ice melting.materials. For example, ice melting.

Chemical changes change the Chemical changes change the chemical composition of the involved chemical composition of the involved

materials. For example, water materials. For example, water decomposing into hydrogen gas and decomposing into hydrogen gas and

oxygen gas.oxygen gas.

Classify each of the following Classify each of the following as either a physical change or as either a physical change or

a chemical change.a chemical change.

tearing a sheet of papertearing a sheet of papermelting a piece of waxmelting a piece of wax

burning a logburning a log

Item 53Item 53